C20H19N3O3 — CID 110308683
1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-2-yl-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone (PubChem CID 110308683) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-2-yl-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone.
| Compound Name | 1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-2-yl-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone |
|---|---|
| PubChem CID | 110308683 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-2-yl-[5-(furan-2-yl)-1,2-oxazol-3-yl]methanone |
| SMILES | O=C(c1cc(-c2ccco2)on1)N1CCN2CCc3ccccc3C2C1 |
| InChI | InChI=1S/C20H19N3O3/c24-20(16-12-19(26-21-16)18-6-3-11-25-18)23-10-9-22-8-7-14-4-1-2-5-15(14)17(22)13-23/h1-6,11-12,17H,7-10,13H2 |
| InChIKey | CXELGMPCAPADTO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 62.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |