About 3-azido-6-methyl-2,3-dihydrochromen-4-one
3-azido-6-methyl-2,3-dihydrochromen-4-one (PubChem CID 11030906) has the molecular formula C10H9N3O2
and a molecular weight of 203.20 g/mol. Its IUPAC name is 3-azido-6-methyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 3-azido-6-methyl-2,3-dihydrochromen-4-one |
| PubChem CID | 11030906 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 3-azido-6-methyl-2,3-dihydrochromen-4-one |
| SMILES | Cc1ccc2c(c1)C(=O)C(N=[N+]=[N-])CO2 |
| InChI | InChI=1S/C10H9N3O2/c1-6-2-3-9-7(4-6)10(14)8(5-15-9)12-13-11/h2-4,8H,5H2,1H3 |
| InChIKey | RFXUQQYEGOBPPD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-azido-6-methyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azido-6-methyl-2,3-dihydrochromen-4-one?
The IUPAC name of 3-azido-6-methyl-2,3-dihydrochromen-4-one (CID 11030906) is 3-azido-6-methyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 3-azido-6-methyl-2,3-dihydrochromen-4-one?
The canonical SMILES for 3-azido-6-methyl-2,3-dihydrochromen-4-one is Cc1ccc2c(c1)C(=O)C(N=[N+]=[N-])CO2.
What is the InChIKey of 3-azido-6-methyl-2,3-dihydrochromen-4-one?
The InChIKey is RFXUQQYEGOBPPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2/c1-6-2-3-9-7(4-6)10(14)8(5-15-9)12-13-11/h2-4,8H,5H2,1H3.
What are the key properties of 3-azido-6-methyl-2,3-dihydrochromen-4-one?
3-azido-6-methyl-2,3-dihydrochromen-4-one has a molecular weight of 203.20 g/mol, XLogP of 2.25, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azido-6-methyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 11030906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).