About methyl 2-ethyl-5,5-dimethoxypentanoate
methyl 2-ethyl-5,5-dimethoxypentanoate (PubChem CID 11030935) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is methyl 2-ethyl-5,5-dimethoxypentanoate.
Molecular Properties
| Compound Name | methyl 2-ethyl-5,5-dimethoxypentanoate |
| PubChem CID | 11030935 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | methyl 2-ethyl-5,5-dimethoxypentanoate |
| SMILES | CCC(CCC(OC)OC)C(=O)OC |
| InChI | InChI=1S/C10H20O4/c1-5-8(10(11)14-4)6-7-9(12-2)13-3/h8-9H,5-7H2,1-4H3 |
| InChIKey | OSOORWBIBFIFCK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-ethyl-5,5-dimethoxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethyl-5,5-dimethoxypentanoate?
The IUPAC name of methyl 2-ethyl-5,5-dimethoxypentanoate (CID 11030935) is methyl 2-ethyl-5,5-dimethoxypentanoate.
What is the SMILES notation for methyl 2-ethyl-5,5-dimethoxypentanoate?
The canonical SMILES for methyl 2-ethyl-5,5-dimethoxypentanoate is CCC(CCC(OC)OC)C(=O)OC.
What is the InChIKey of methyl 2-ethyl-5,5-dimethoxypentanoate?
The InChIKey is OSOORWBIBFIFCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c1-5-8(10(11)14-4)6-7-9(12-2)13-3/h8-9H,5-7H2,1-4H3.
What are the key properties of methyl 2-ethyl-5,5-dimethoxypentanoate?
methyl 2-ethyl-5,5-dimethoxypentanoate has a molecular weight of 204.27 g/mol, XLogP of 1.58, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-5,5-dimethoxypentanoate is sourced from PubChem (CID 11030935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).