About [1-(1,1-dioxothiolan-3-yl)-5-thiophen-2-ylpyrazol-3-yl]-(3-methylmorpholin-4-yl)methanone
[1-(1,1-dioxothiolan-3-yl)-5-thiophen-2-ylpyrazol-3-yl]-(3-methylmorpholin-4-yl)methanone (PubChem CID 110309840) has the molecular formula C17H21N3O4S2
and a molecular weight of 395.51 g/mol. Its IUPAC name is [1-(1,1-dioxothiolan-3-yl)-5-thiophen-2-ylpyrazol-3-yl]-(3-methylmorpholin-4-yl)methanone.
Molecular Properties
| Compound Name | [1-(1,1-dioxothiolan-3-yl)-5-thiophen-2-ylpyrazol-3-yl]-(3-methylmorpholin-4-yl)methanone |
| PubChem CID | 110309840 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [1-(1,1-dioxothiolan-3-yl)-5-thiophen-2-ylpyrazol-3-yl]-(3-methylmorpholin-4-yl)methanone |
| SMILES | CC1COCCN1C(=O)c1cc(-c2cccs2)n(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C17H21N3O4S2/c1-12-10-24-6-5-19(12)17(21)14-9-15(16-3-2-7-25-16)20(18-14)13-4-8-26(22,23)11-13/h2-3,7,9,12-13H,4-6,8,10-11H2,1H3 |
| InChIKey | AAXKCQXYEHQUGX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-(1,1-dioxothiolan-3-yl)-5-thiophen-2-ylpyrazol-3-yl]-(3-methylmorpholin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,1-dioxothiolan-3-yl)-5-thiophen-2-ylpyrazol-3-yl]-(3-methylmorpholin-4-yl)methanone?
The IUPAC name of [1-(1,1-dioxothiolan-3-yl)-5-thiophen-2-ylpyrazol-3-yl]-(3-methylmorpholin-4-yl)methanone (CID 110309840) is [1-(1,1-dioxothiolan-3-yl)-5-thiophen-2-ylpyrazol-3-yl]-(3-methylmorpholin-4-yl)methanone.
What is the SMILES notation for [1-(1,1-dioxothiolan-3-yl)-5-thiophen-2-ylpyrazol-3-yl]-(3-methylmorpholin-4-yl)methanone?
The canonical SMILES for [1-(1,1-dioxothiolan-3-yl)-5-thiophen-2-ylpyrazol-3-yl]-(3-methylmorpholin-4-yl)methanone is CC1COCCN1C(=O)c1cc(-c2cccs2)n(C2CCS(=O)(=O)C2)n1.
What is the InChIKey of [1-(1,1-dioxothiolan-3-yl)-5-thiophen-2-ylpyrazol-3-yl]-(3-methylmorpholin-4-yl)methanone?
The InChIKey is AAXKCQXYEHQUGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O4S2/c1-12-10-24-6-5-19(12)17(21)14-9-15(16-3-2-7-25-16)20(18-14)13-4-8-26(22,23)11-13/h2-3,7,9,12-13H,4-6,8,10-11H2,1H3.
What are the key properties of [1-(1,1-dioxothiolan-3-yl)-5-thiophen-2-ylpyrazol-3-yl]-(3-methylmorpholin-4-yl)methanone?
[1-(1,1-dioxothiolan-3-yl)-5-thiophen-2-ylpyrazol-3-yl]-(3-methylmorpholin-4-yl)methanone has a molecular weight of 395.51 g/mol, XLogP of 1.83, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,1-dioxothiolan-3-yl)-5-thiophen-2-ylpyrazol-3-yl]-(3-methylmorpholin-4-yl)methanone is sourced from PubChem (CID 110309840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).