About N-buta-2,3-dienyl-4-chloro-N-ethylaniline
N-buta-2,3-dienyl-4-chloro-N-ethylaniline (PubChem CID 11031031) has the molecular formula C12H14ClN
and a molecular weight of 207.70 g/mol. Its IUPAC name is N-buta-2,3-dienyl-4-chloro-N-ethylaniline.
Molecular Properties
| Compound Name | N-buta-2,3-dienyl-4-chloro-N-ethylaniline |
| PubChem CID | 11031031 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N-buta-2,3-dienyl-4-chloro-N-ethylaniline |
| SMILES | C=C=CCN(CC)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14ClN/c1-3-5-10-14(4-2)12-8-6-11(13)7-9-12/h5-9H,1,4,10H2,2H3 |
| InChIKey | ZNLOBPCBOAYUGP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-buta-2,3-dienyl-4-chloro-N-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-buta-2,3-dienyl-4-chloro-N-ethylaniline?
The IUPAC name of N-buta-2,3-dienyl-4-chloro-N-ethylaniline (CID 11031031) is N-buta-2,3-dienyl-4-chloro-N-ethylaniline.
What is the SMILES notation for N-buta-2,3-dienyl-4-chloro-N-ethylaniline?
The canonical SMILES for N-buta-2,3-dienyl-4-chloro-N-ethylaniline is C=C=CCN(CC)c1ccc(Cl)cc1.
What is the InChIKey of N-buta-2,3-dienyl-4-chloro-N-ethylaniline?
The InChIKey is ZNLOBPCBOAYUGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN/c1-3-5-10-14(4-2)12-8-6-11(13)7-9-12/h5-9H,1,4,10H2,2H3.
What are the key properties of N-buta-2,3-dienyl-4-chloro-N-ethylaniline?
N-buta-2,3-dienyl-4-chloro-N-ethylaniline has a molecular weight of 207.70 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-buta-2,3-dienyl-4-chloro-N-ethylaniline is sourced from PubChem (CID 11031031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).