C11H15NO3 — CID 11031075
3-[(1S,2R)-2-methylcyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 11031075) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 3-[(1S,2R)-2-methylcyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(1S,2R)-2-methylcyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11031075 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 3-[(1S,2R)-2-methylcyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H]1C=CCC[C@@H]1C(=O)N1CCOC1=O |
| InChI | InChI=1S/C11H15NO3/c1-8-4-2-3-5-9(8)10(13)12-6-7-15-11(12)14/h2,4,8-9H,3,5-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | DYDKSSSZRASYQV-BDAKNGLRSA-N |
| XLogP | 1.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|