C11H14O4 — CID 11031089
(3aR,5S,6aR)-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,4'-cyclopent-2-ene]-1'-one (PubChem CID 11031089) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (3aR,5S,6aR)-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,4'-cyclopent-2-ene]-1'-one.
| Compound Name | (3aR,5S,6aR)-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,4'-cyclopent-2-ene]-1'-one |
|---|---|
| PubChem CID | 11031089 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (3aR,5S,6aR)-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-5,4'-cyclopent-2-ene]-1'-one |
| SMILES | CC1(C)O[C@H]2O[C@@]3(C=CC(=O)C3)C[C@H]2O1 |
| InChI | InChI=1S/C11H14O4/c1-10(2)13-8-6-11(15-9(8)14-10)4-3-7(12)5-11/h3-4,8-9H,5-6H2,1-2H3/t8-,9+,11-/m1/s1 |
| InChIKey | WJFZDHOGSZWEKG-WCABBAIRSA-N |
| XLogP | 1.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |