About (2R,3R)-2-methyl-2,3-diphenyloxirane
(2R,3R)-2-methyl-2,3-diphenyloxirane (PubChem CID 11031103) has the molecular formula C15H14O
and a molecular weight of 210.28 g/mol. Its IUPAC name is (2R,3R)-2-methyl-2,3-diphenyloxirane.
Molecular Properties
| Compound Name | (2R,3R)-2-methyl-2,3-diphenyloxirane |
| PubChem CID | 11031103 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (2R,3R)-2-methyl-2,3-diphenyloxirane |
| SMILES | C[C@]1(c2ccccc2)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H14O/c1-15(13-10-6-3-7-11-13)14(16-15)12-8-4-2-5-9-12/h2-11,14H,1H3/t14-,15-/m1/s1 |
| InChIKey | SDLOAJBYHVVDQI-HUUCEWRRSA-N |
| XLogP | 3.67 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2-methyl-2,3-diphenyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2-methyl-2,3-diphenyloxirane?
The IUPAC name of (2R,3R)-2-methyl-2,3-diphenyloxirane (CID 11031103) is (2R,3R)-2-methyl-2,3-diphenyloxirane.
What is the SMILES notation for (2R,3R)-2-methyl-2,3-diphenyloxirane?
The canonical SMILES for (2R,3R)-2-methyl-2,3-diphenyloxirane is C[C@]1(c2ccccc2)O[C@@H]1c1ccccc1.
What is the InChIKey of (2R,3R)-2-methyl-2,3-diphenyloxirane?
The InChIKey is SDLOAJBYHVVDQI-HUUCEWRRSA-N. The full InChI is InChI=1S/C15H14O/c1-15(13-10-6-3-7-11-13)14(16-15)12-8-4-2-5-9-12/h2-11,14H,1H3/t14-,15-/m1/s1.
What are the key properties of (2R,3R)-2-methyl-2,3-diphenyloxirane?
(2R,3R)-2-methyl-2,3-diphenyloxirane has a molecular weight of 210.28 g/mol, XLogP of 3.67, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2-methyl-2,3-diphenyloxirane is sourced from PubChem (CID 11031103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).