C13H22O2 — CID 11031108
(4aS,6S,8aS)-6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 11031108) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (4aS,6S,8aS)-6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one.
| Compound Name | (4aS,6S,8aS)-6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 11031108 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (4aS,6S,8aS)-6-hydroxy-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C)C(=O)CCC[C@@H]12 |
| InChI | InChI=1S/C13H22O2/c1-12(2)9-5-4-6-11(15)13(9,3)8-7-10(12)14/h9-10,14H,4-8H2,1-3H3/t9-,10-,13-/m0/s1 |
| InChIKey | AHDYLRWAUNFSSU-KWBADKCTSA-N |
| XLogP | 2.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |