C20H23NO5 — CID 110311300
5-(4-methoxyphenyl)-5-oxo-N-(2-phenoxyethoxy)pentanamide (PubChem CID 110311300) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-5-oxo-N-(2-phenoxyethoxy)pentanamide.
| Compound Name | 5-(4-methoxyphenyl)-5-oxo-N-(2-phenoxyethoxy)pentanamide |
|---|---|
| PubChem CID | 110311300 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 5-(4-methoxyphenyl)-5-oxo-N-(2-phenoxyethoxy)pentanamide |
| SMILES | COc1ccc(C(=O)CCCC(=O)NOCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO5/c1-24-17-12-10-16(11-13-17)19(22)8-5-9-20(23)21-26-15-14-25-18-6-3-2-4-7-18/h2-4,6-7,10-13H,5,8-9,14-15H2,1H3,(H,21,23) |
| InChIKey | OIMZQXDCXFYNDM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|