C11H16O4 — CID 11031146
(1S,4S,7R,11R)-3,9-dimethoxy-2,10-dioxatricyclo[5.3.1.04,11]undec-5-ene (PubChem CID 11031146) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (1S,4S,7R,11R)-3,9-dimethoxy-2,10-dioxatricyclo[5.3.1.04,11]undec-5-ene.
| Compound Name | (1S,4S,7R,11R)-3,9-dimethoxy-2,10-dioxatricyclo[5.3.1.04,11]undec-5-ene |
|---|---|
| PubChem CID | 11031146 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (1S,4S,7R,11R)-3,9-dimethoxy-2,10-dioxatricyclo[5.3.1.04,11]undec-5-ene |
| SMILES | COC1C[C@@H]2C=C[C@@H]3C(OC)O[C@H](O1)[C@@H]32 |
| InChI | InChI=1S/C11H16O4/c1-12-8-5-6-3-4-7-9(6)11(14-8)15-10(7)13-2/h3-4,6-11H,5H2,1-2H3/t6-,7-,8?,9+,10?,11-/m0/s1 |
| InChIKey | GMKGCRISXUVRDK-HMCILURBSA-N |
| XLogP | 1.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|