C15H24O — CID 11031401
(4aS,6R,8aR)-4a,8a-dimethyl-6-propan-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-one (PubChem CID 11031401) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (4aS,6R,8aR)-4a,8a-dimethyl-6-propan-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-one.
| Compound Name | (4aS,6R,8aR)-4a,8a-dimethyl-6-propan-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 11031401 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (4aS,6R,8aR)-4a,8a-dimethyl-6-propan-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-one |
| SMILES | CC(C)[C@@H]1CC[C@]2(C)CC(=O)C=C[C@]2(C)C1 |
| InChI | InChI=1S/C15H24O/c1-11(2)12-5-7-15(4)10-13(16)6-8-14(15,3)9-12/h6,8,11-12H,5,7,9-10H2,1-4H3/t12-,14-,15-/m1/s1 |
| InChIKey | PIGAETUEUXKOSG-BPLDGKMQSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |