C11H16O5 — CID 11031608
[(3S,3aR,6R,6aR)-3-prop-2-enoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] acetate (PubChem CID 11031608) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is [(3S,3aR,6R,6aR)-3-prop-2-enoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] acetate.
| Compound Name | [(3S,3aR,6R,6aR)-3-prop-2-enoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] acetate |
|---|---|
| PubChem CID | 11031608 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | [(3S,3aR,6R,6aR)-3-prop-2-enoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] acetate |
| SMILES | C=CCO[C@H]1CO[C@H]2[C@@H]1OC[C@H]2OC(C)=O |
| InChI | InChI=1S/C11H16O5/c1-3-4-13-8-5-14-11-9(16-7(2)12)6-15-10(8)11/h3,8-11H,1,4-6H2,2H3/t8-,9+,10+,11+/m0/s1 |
| InChIKey | KAXWZHPCKWIHMP-LNFKQOIKSA-N |
| XLogP | 0.29 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|