C17H23N3O2S — CID 110317498
1,1-diethyl-3-[2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]ethyl]urea (PubChem CID 110317498) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is 1,1-diethyl-3-[2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]ethyl]urea.
| Compound Name | 1,1-diethyl-3-[2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]ethyl]urea |
|---|---|
| PubChem CID | 110317498 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1,1-diethyl-3-[2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]ethyl]urea |
| SMILES | CCN(CC)C(=O)NCCc1csc(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C17H23N3O2S/c1-4-20(5-2)17(21)18-11-10-14-12-23-16(19-14)13-6-8-15(22-3)9-7-13/h6-9,12H,4-5,10-11H2,1-3H3,(H,18,21) |
| InChIKey | KQGDTVWQPRIJRU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |