C18H19N3O2S2 — CID 110317833
4-ethyl-N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]benzenesulfonamide (PubChem CID 110317833) has the molecular formula C18H19N3O2S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 4-ethyl-N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-ethyl-N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110317833 |
| Molecular Formula | C18H19N3O2S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 4-ethyl-N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCc2nc(-c3ccncc3)cs2)cc1 |
| InChI | InChI=1S/C18H19N3O2S2/c1-2-14-3-5-16(6-4-14)25(22,23)20-12-9-18-21-17(13-24-18)15-7-10-19-11-8-15/h3-8,10-11,13,20H,2,9,12H2,1H3 |
| InChIKey | USDPJCMBUYQIJR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |