About 5-oxo-6,11-dihydrobenzo[b][1]benzazepine-6-carbonitrile
5-oxo-6,11-dihydrobenzo[b][1]benzazepine-6-carbonitrile (PubChem CID 11031795) has the molecular formula C15H10N2O
and a molecular weight of 234.26 g/mol. Its IUPAC name is 5-oxo-6,11-dihydrobenzo[b][1]benzazepine-6-carbonitrile.
Molecular Properties
| Compound Name | 5-oxo-6,11-dihydrobenzo[b][1]benzazepine-6-carbonitrile |
| PubChem CID | 11031795 |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 5-oxo-6,11-dihydrobenzo[b][1]benzazepine-6-carbonitrile |
| SMILES | N#CC1C(=O)c2ccccc2Nc2ccccc21 |
| InChI | InChI=1S/C15H10N2O/c16-9-12-10-5-1-3-7-13(10)17-14-8-4-2-6-11(14)15(12)18/h1-8,12,17H |
| InChIKey | OZXFNWPZRZATNT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-oxo-6,11-dihydrobenzo[b][1]benzazepine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-6,11-dihydrobenzo[b][1]benzazepine-6-carbonitrile?
The IUPAC name of 5-oxo-6,11-dihydrobenzo[b][1]benzazepine-6-carbonitrile (CID 11031795) is 5-oxo-6,11-dihydrobenzo[b][1]benzazepine-6-carbonitrile.
What is the SMILES notation for 5-oxo-6,11-dihydrobenzo[b][1]benzazepine-6-carbonitrile?
The canonical SMILES for 5-oxo-6,11-dihydrobenzo[b][1]benzazepine-6-carbonitrile is N#CC1C(=O)c2ccccc2Nc2ccccc21.
What is the InChIKey of 5-oxo-6,11-dihydrobenzo[b][1]benzazepine-6-carbonitrile?
The InChIKey is OZXFNWPZRZATNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O/c16-9-12-10-5-1-3-7-13(10)17-14-8-4-2-6-11(14)15(12)18/h1-8,12,17H.
What are the key properties of 5-oxo-6,11-dihydrobenzo[b][1]benzazepine-6-carbonitrile?
5-oxo-6,11-dihydrobenzo[b][1]benzazepine-6-carbonitrile has a molecular weight of 234.26 g/mol, XLogP of 3.23, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-6,11-dihydrobenzo[b][1]benzazepine-6-carbonitrile is sourced from PubChem (CID 11031795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).