C15H17N3O3 — CID 110320373
N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]oxolane-2-carboxamide (PubChem CID 110320373) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 110320373 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]oxolane-2-carboxamide |
| SMILES | O=C(NCCc1nnc(-c2ccccc2)o1)C1CCCO1 |
| InChI | InChI=1S/C15H17N3O3/c19-14(12-7-4-10-20-12)16-9-8-13-17-18-15(21-13)11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,16,19) |
| InChIKey | CFMDVYWLNQEZLD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |