C17H16N4O3 — CID 110320666
4-methoxy-N-[2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)ethyl]benzamide (PubChem CID 110320666) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-methoxy-N-[2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110320666 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-methoxy-N-[2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCc2nnc(-c3cccnc3)o2)cc1 |
| InChI | InChI=1S/C17H16N4O3/c1-23-14-6-4-12(5-7-14)16(22)19-10-8-15-20-21-17(24-15)13-3-2-9-18-11-13/h2-7,9,11H,8,10H2,1H3,(H,19,22) |
| InChIKey | XCOGYMHZWIEFKS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |