C22H18N4O2 — CID 110320848
3-phenyl-N-[2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)ethyl]benzamide (PubChem CID 110320848) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-phenyl-N-[2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)ethyl]benzamide.
| Compound Name | 3-phenyl-N-[2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 110320848 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-phenyl-N-[2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1nnc(-c2ccncc2)o1)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H18N4O2/c27-21(19-8-4-7-18(15-19)16-5-2-1-3-6-16)24-14-11-20-25-26-22(28-20)17-9-12-23-13-10-17/h1-10,12-13,15H,11,14H2,(H,24,27) |
| InChIKey | OZQOMBIZRWXAPW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |