C18H14F3N3O2 — CID 110321334
2,3,4-trifluoro-N-[2-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl]benzamide (PubChem CID 110321334) has the molecular formula C18H14F3N3O2 and a molecular weight of 361.32 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[2-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 110321334 |
| Molecular Formula | C18H14F3N3O2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl]benzamide |
| SMILES | Cc1cccc(-c2nnc(CCNC(=O)c3ccc(F)c(F)c3F)o2)c1 |
| InChI | InChI=1S/C18H14F3N3O2/c1-10-3-2-4-11(9-10)18-24-23-14(26-18)7-8-22-17(25)12-5-6-13(19)16(21)15(12)20/h2-6,9H,7-8H2,1H3,(H,22,25) |
| InChIKey | BYPJDSJTEJJTSF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|