About ethyl 2-benzyl-3,3,3-trifluoropropanoate
ethyl 2-benzyl-3,3,3-trifluoropropanoate (PubChem CID 11032151) has the molecular formula C12H13F3O2
and a molecular weight of 246.23 g/mol. Its IUPAC name is ethyl 2-benzyl-3,3,3-trifluoropropanoate.
Molecular Properties
| Compound Name | ethyl 2-benzyl-3,3,3-trifluoropropanoate |
| PubChem CID | 11032151 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | ethyl 2-benzyl-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3O2/c1-2-17-11(16)10(12(13,14)15)8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3 |
| InChIKey | BMJKXFOXXSIRLD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 2-benzyl-3,3,3-trifluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-benzyl-3,3,3-trifluoropropanoate?
The IUPAC name of ethyl 2-benzyl-3,3,3-trifluoropropanoate (CID 11032151) is ethyl 2-benzyl-3,3,3-trifluoropropanoate.
What is the SMILES notation for ethyl 2-benzyl-3,3,3-trifluoropropanoate?
The canonical SMILES for ethyl 2-benzyl-3,3,3-trifluoropropanoate is CCOC(=O)C(Cc1ccccc1)C(F)(F)F.
What is the InChIKey of ethyl 2-benzyl-3,3,3-trifluoropropanoate?
The InChIKey is BMJKXFOXXSIRLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3O2/c1-2-17-11(16)10(12(13,14)15)8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3.
What are the key properties of ethyl 2-benzyl-3,3,3-trifluoropropanoate?
ethyl 2-benzyl-3,3,3-trifluoropropanoate has a molecular weight of 246.23 g/mol, XLogP of 2.97, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-benzyl-3,3,3-trifluoropropanoate is sourced from PubChem (CID 11032151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).