C12H15N3O2S — CID 110323159
N-[2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)ethyl]butanamide (PubChem CID 110323159) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is N-[2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)ethyl]butanamide.
| Compound Name | N-[2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 110323159 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | N-[2-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)ethyl]butanamide |
| SMILES | CCCC(=O)NCCc1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C12H15N3O2S/c1-2-4-10(16)13-7-6-11-14-12(15-17-11)9-5-3-8-18-9/h3,5,8H,2,4,6-7H2,1H3,(H,13,16) |
| InChIKey | ZNYNSKQUBBZHGQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |