C18H16FN3O3 — CID 110323449
benzyl N-[2-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]carbamate (PubChem CID 110323449) has the molecular formula C18H16FN3O3 and a molecular weight of 341.34 g/mol. Its IUPAC name is benzyl N-[2-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]carbamate.
| Compound Name | benzyl N-[2-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 110323449 |
| Molecular Formula | C18H16FN3O3 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | benzyl N-[2-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]carbamate |
| SMILES | O=C(NCCc1nc(-c2ccccc2F)no1)OCc1ccccc1 |
| InChI | InChI=1S/C18H16FN3O3/c19-15-9-5-4-8-14(15)17-21-16(25-22-17)10-11-20-18(23)24-12-13-6-2-1-3-7-13/h1-9H,10-12H2,(H,20,23) |
| InChIKey | HKGFTSXHCGPTPX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |