About 1,2-dimethylspiro[cyclopentene-4,2'-thiochromene]-4'-carbonitrile
1,2-dimethylspiro[cyclopentene-4,2'-thiochromene]-4'-carbonitrile (PubChem CID 11032408) has the molecular formula C16H15NS
and a molecular weight of 253.37 g/mol. Its IUPAC name is 1,2-dimethylspiro[cyclopentene-4,2'-thiochromene]-4'-carbonitrile.
Molecular Properties
| Compound Name | 1,2-dimethylspiro[cyclopentene-4,2'-thiochromene]-4'-carbonitrile |
| PubChem CID | 11032408 |
| Molecular Formula | C16H15NS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1,2-dimethylspiro[cyclopentene-4,2'-thiochromene]-4'-carbonitrile |
| SMILES | CC1=C(C)CC2(C=C(C#N)c3ccccc3S2)C1 |
| InChI | InChI=1S/C16H15NS/c1-11-7-16(8-12(11)2)9-13(10-17)14-5-3-4-6-15(14)18-16/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | KTODLPFVCZDXHF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylspiro[cyclopentene-4,2'-thiochromene]-4'-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylspiro[cyclopentene-4,2'-thiochromene]-4'-carbonitrile?
The IUPAC name of 1,2-dimethylspiro[cyclopentene-4,2'-thiochromene]-4'-carbonitrile (CID 11032408) is 1,2-dimethylspiro[cyclopentene-4,2'-thiochromene]-4'-carbonitrile.
What is the SMILES notation for 1,2-dimethylspiro[cyclopentene-4,2'-thiochromene]-4'-carbonitrile?
The canonical SMILES for 1,2-dimethylspiro[cyclopentene-4,2'-thiochromene]-4'-carbonitrile is CC1=C(C)CC2(C=C(C#N)c3ccccc3S2)C1.
What is the InChIKey of 1,2-dimethylspiro[cyclopentene-4,2'-thiochromene]-4'-carbonitrile?
The InChIKey is KTODLPFVCZDXHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NS/c1-11-7-16(8-12(11)2)9-13(10-17)14-5-3-4-6-15(14)18-16/h3-6,9H,7-8H2,1-2H3.
What are the key properties of 1,2-dimethylspiro[cyclopentene-4,2'-thiochromene]-4'-carbonitrile?
1,2-dimethylspiro[cyclopentene-4,2'-thiochromene]-4'-carbonitrile has a molecular weight of 253.37 g/mol, XLogP of 4.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylspiro[cyclopentene-4,2'-thiochromene]-4'-carbonitrile is sourced from PubChem (CID 11032408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).