C22H19N3O4 — CID 110324410
3-(1,3-dioxoisoindol-2-yl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide (PubChem CID 110324410) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 110324410 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]propanamide |
| SMILES | Cc1cccc2cc(CNC(=O)CCN3C(=O)c4ccccc4C3=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C22H19N3O4/c1-13-5-4-6-14-11-15(20(27)24-19(13)14)12-23-18(26)9-10-25-21(28)16-7-2-3-8-17(16)22(25)29/h2-8,11H,9-10,12H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | KNRZIGJUQMOXJC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|