C15H17NO3 — CID 11032597
3-cyclohexyl-5-phenyl-1,3-oxazolidine-2,4-dione (PubChem CID 11032597) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-cyclohexyl-5-phenyl-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-cyclohexyl-5-phenyl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 11032597 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 3-cyclohexyl-5-phenyl-1,3-oxazolidine-2,4-dione |
| SMILES | O=C1OC(c2ccccc2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C15H17NO3/c17-14-13(11-7-3-1-4-8-11)19-15(18)16(14)12-9-5-2-6-10-12/h1,3-4,7-8,12-13H,2,5-6,9-10H2 |
| InChIKey | WMXOAOHGRAMPJR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |