C12H25NO3Si — CID 11032609
(3R,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methoxyazetidin-2-one (PubChem CID 11032609) has the molecular formula C12H25NO3Si and a molecular weight of 259.42 g/mol. Its IUPAC name is (3R,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methoxyazetidin-2-one.
| Compound Name | (3R,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methoxyazetidin-2-one |
|---|---|
| PubChem CID | 11032609 |
| Molecular Formula | C12H25NO3Si |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (3R,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methoxyazetidin-2-one |
| SMILES | CO[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H25NO3Si/c1-8(9-10(14)13-11(9)15-5)16-17(6,7)12(2,3)4/h8-9,11H,1-7H3,(H,13,14)/t8-,9+,11-/m1/s1 |
| InChIKey | WRYGZMZEDYVKSY-WCABBAIRSA-N |
| XLogP | 2.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|