About N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-methylbenzamide
N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-methylbenzamide (PubChem CID 11032700) has the molecular formula C14H22N4O
and a molecular weight of 262.36 g/mol. Its IUPAC name is N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-methylbenzamide.
Molecular Properties
| Compound Name | N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-methylbenzamide |
| PubChem CID | 11032700 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N/C(N)=N/CCCN(C)C)cc1 |
| InChI | InChI=1S/C14H22N4O/c1-11-5-7-12(8-6-11)13(19)17-14(15)16-9-4-10-18(2)3/h5-8H,4,9-10H2,1-3H3,(H3,15,16,17,19) |
| InChIKey | LNIDMBZHISBPJW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-methylbenzamide?
The IUPAC name of N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-methylbenzamide (CID 11032700) is N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-methylbenzamide.
What is the SMILES notation for N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-methylbenzamide?
The canonical SMILES for N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-methylbenzamide is Cc1ccc(C(=O)N/C(N)=N/CCCN(C)C)cc1.
What is the InChIKey of N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-methylbenzamide?
The InChIKey is LNIDMBZHISBPJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O/c1-11-5-7-12(8-6-11)13(19)17-14(15)16-9-4-10-18(2)3/h5-8H,4,9-10H2,1-3H3,(H3,15,16,17,19).
What are the key properties of N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-methylbenzamide?
N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-methylbenzamide has a molecular weight of 262.36 g/mol, XLogP of 0.99, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-methylbenzamide is sourced from PubChem (CID 11032700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).