C20H30N2O2 — CID 110327448
N-cyclohexyl-5,5-dimethyl-2-(4-methylphenyl)morpholine-4-carboxamide (PubChem CID 110327448) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is N-cyclohexyl-5,5-dimethyl-2-(4-methylphenyl)morpholine-4-carboxamide.
| Compound Name | N-cyclohexyl-5,5-dimethyl-2-(4-methylphenyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 110327448 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | N-cyclohexyl-5,5-dimethyl-2-(4-methylphenyl)morpholine-4-carboxamide |
| SMILES | Cc1ccc(C2CN(C(=O)NC3CCCCC3)C(C)(C)CO2)cc1 |
| InChI | InChI=1S/C20H30N2O2/c1-15-9-11-16(12-10-15)18-13-22(20(2,3)14-24-18)19(23)21-17-7-5-4-6-8-17/h9-12,17-18H,4-8,13-14H2,1-3H3,(H,21,23) |
| InChIKey | UAGBRAXQXMIRRT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |