C17H24FNO2 — CID 110327503
1-[2-(4-fluorophenyl)-5,5-dimethylmorpholin-4-yl]pentan-1-one (PubChem CID 110327503) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-5,5-dimethylmorpholin-4-yl]pentan-1-one.
| Compound Name | 1-[2-(4-fluorophenyl)-5,5-dimethylmorpholin-4-yl]pentan-1-one |
|---|---|
| PubChem CID | 110327503 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-5,5-dimethylmorpholin-4-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CC(c2ccc(F)cc2)OCC1(C)C |
| InChI | InChI=1S/C17H24FNO2/c1-4-5-6-16(20)19-11-15(21-12-17(19,2)3)13-7-9-14(18)10-8-13/h7-10,15H,4-6,11-12H2,1-3H3 |
| InChIKey | IZUWWZRWXOSJQP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |