C10H13Cl3N2 — CID 11032853
3-(trichloromethyl)-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole (PubChem CID 11032853) has the molecular formula C10H13Cl3N2 and a molecular weight of 267.59 g/mol. Its IUPAC name is 3-(trichloromethyl)-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole.
| Compound Name | 3-(trichloromethyl)-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole |
|---|---|
| PubChem CID | 11032853 |
| Molecular Formula | C10H13Cl3N2 |
| Molecular Weight | 267.59 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 3-(trichloromethyl)-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole |
| SMILES | ClC(Cl)(Cl)c1n[nH]c2c1CCCCCC2 |
| InChI | InChI=1S/C10H13Cl3N2/c11-10(12,13)9-7-5-3-1-2-4-6-8(7)14-15-9/h1-6H2,(H,14,15) |
| InChIKey | SWQFZWPYARFZNJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|