C13H19N3O6S — CID 110328637
ethyl 2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-2-oxoacetate (PubChem CID 110328637) has the molecular formula C13H19N3O6S and a molecular weight of 345.38 g/mol. Its IUPAC name is ethyl 2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 110328637 |
| Molecular Formula | C13H19N3O6S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | ethyl 2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N1CCN(S(=O)(=O)c2c(C)noc2C)CC1 |
| InChI | InChI=1S/C13H19N3O6S/c1-4-21-13(18)12(17)15-5-7-16(8-6-15)23(19,20)11-9(2)14-22-10(11)3/h4-8H2,1-3H3 |
| InChIKey | OFQMRTFFEFDVSB-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 110.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|