C15H26O4 — CID 11032932
ethyl (E)-3-[(4R,5R)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 11032932) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is ethyl (E)-3-[(4R,5R)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(4R,5R)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11032932 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | ethyl (E)-3-[(4R,5R)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | CCCCC[C@H]1OC(C)(C)O[C@@H]1/C=C/C(=O)OCC |
| InChI | InChI=1S/C15H26O4/c1-5-7-8-9-12-13(19-15(3,4)18-12)10-11-14(16)17-6-2/h10-13H,5-9H2,1-4H3/b11-10+/t12-,13-/m1/s1 |
| InChIKey | IXZYYILEEOJNTD-HRFIDBLHSA-N |
| XLogP | 3.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|