C18H22O2 — CID 11032935
(3aS,7aS)-3-hydroxy-2-(2,4,6-trimethylphenyl)-3a,4,5,6,7,7a-hexahydroinden-1-one (PubChem CID 11032935) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (3aS,7aS)-3-hydroxy-2-(2,4,6-trimethylphenyl)-3a,4,5,6,7,7a-hexahydroinden-1-one.
| Compound Name | (3aS,7aS)-3-hydroxy-2-(2,4,6-trimethylphenyl)-3a,4,5,6,7,7a-hexahydroinden-1-one |
|---|---|
| PubChem CID | 11032935 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (3aS,7aS)-3-hydroxy-2-(2,4,6-trimethylphenyl)-3a,4,5,6,7,7a-hexahydroinden-1-one |
| SMILES | Cc1cc(C)c(C2=C(O)[C@H]3CCCC[C@@H]3C2=O)c(C)c1 |
| InChI | InChI=1S/C18H22O2/c1-10-8-11(2)15(12(3)9-10)16-17(19)13-6-4-5-7-14(13)18(16)20/h8-9,13-14,19H,4-7H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | SFOZZPKOCDMLGA-KBPBESRZSA-N |
| XLogP | 4.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |