C19H23N3OS — CID 110329851
N-[2-(cyclohexen-1-yl)ethyl]-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)propanamide (PubChem CID 110329851) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)propanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)propanamide |
|---|---|
| PubChem CID | 110329851 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)propanamide |
| SMILES | O=C(CCc1csc(-c2cccnc2)n1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C19H23N3OS/c23-18(21-12-10-15-5-2-1-3-6-15)9-8-17-14-24-19(22-17)16-7-4-11-20-13-16/h4-5,7,11,13-14H,1-3,6,8-10,12H2,(H,21,23) |
| InChIKey | MHUOAGFKFKLOHJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|