C19H20N4O2 — CID 110330622
N-[4-(dimethylamino)phenyl]-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanamide (PubChem CID 110330622) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 110330622 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanamide |
| SMILES | CN(C)c1ccc(NC(=O)CCc2nc(-c3ccccc3)no2)cc1 |
| InChI | InChI=1S/C19H20N4O2/c1-23(2)16-10-8-15(9-11-16)20-17(24)12-13-18-21-19(22-25-18)14-6-4-3-5-7-14/h3-11H,12-13H2,1-2H3,(H,20,24) |
| InChIKey | RWUNEFPQROMFNH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|