C15H17NO4 — CID 11033090
methyl (2R)-1-[(2R,3S)-3-phenyloxirane-2-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 11033090) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is methyl (2R)-1-[(2R,3S)-3-phenyloxirane-2-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[(2R,3S)-3-phenyloxirane-2-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11033090 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | methyl (2R)-1-[(2R,3S)-3-phenyloxirane-2-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN1C(=O)[C@@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H17NO4/c1-19-15(18)11-8-5-9-16(11)14(17)13-12(20-13)10-6-3-2-4-7-10/h2-4,6-7,11-13H,5,8-9H2,1H3/t11-,12+,13-/m1/s1 |
| InChIKey | YIYATJPSUWCKHU-FRRDWIJNSA-N |
| XLogP | 1.29 |
| TPSA | 59.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|