C17H24O3 — CID 11033131
(1S,3aS,5S,7aR)-1-(hydroxymethyl)-5-(4-hydroxyphenyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol (PubChem CID 11033131) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (1S,3aS,5S,7aR)-1-(hydroxymethyl)-5-(4-hydroxyphenyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol.
| Compound Name | (1S,3aS,5S,7aR)-1-(hydroxymethyl)-5-(4-hydroxyphenyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol |
|---|---|
| PubChem CID | 11033131 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (1S,3aS,5S,7aR)-1-(hydroxymethyl)-5-(4-hydroxyphenyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-3a-ol |
| SMILES | C[C@]12CC[C@H](c3ccc(O)cc3)C[C@@]1(O)CC[C@@H]2CO |
| InChI | InChI=1S/C17H24O3/c1-16-8-6-13(12-2-4-15(19)5-3-12)10-17(16,20)9-7-14(16)11-18/h2-5,13-14,18-20H,6-11H2,1H3/t13-,14+,16+,17-/m0/s1 |
| InChIKey | GSQAOMXEJCPXQB-ABFRBSLYSA-N |
| XLogP | 2.80 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |