C17H19FN4O3 — CID 110332223
4-(4-fluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxo-1H-pyrimidine-6-carboxamide (PubChem CID 110332223) has the molecular formula C17H19FN4O3 and a molecular weight of 346.36 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxo-1H-pyrimidine-6-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 110332223 |
| Molecular Formula | C17H19FN4O3 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-(4-fluorophenyl)-N-(2-morpholin-4-ylethyl)-2-oxo-1H-pyrimidine-6-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)c1cc(-c2ccc(F)cc2)nc(=O)[nH]1 |
| InChI | InChI=1S/C17H19FN4O3/c18-13-3-1-12(2-4-13)14-11-15(21-17(24)20-14)16(23)19-5-6-22-7-9-25-10-8-22/h1-4,11H,5-10H2,(H,19,23)(H,20,21,24) |
| InChIKey | PGLPTBRIYGEIOE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |