C22H18 — CID 11033332
(2Z)-2-phenyltricyclo[8.2.2.24,7]hexadeca-1(13),2,4,6,10(14),11,15-heptaene (PubChem CID 11033332) has the molecular formula C22H18 and a molecular weight of 282.39 g/mol. Its IUPAC name is (2Z)-2-phenyltricyclo[8.2.2.24,7]hexadeca-1(13),2,4,6,10(14),11,15-heptaene.
| Compound Name | (2Z)-2-phenyltricyclo[8.2.2.24,7]hexadeca-1(13),2,4,6,10(14),11,15-heptaene |
|---|---|
| PubChem CID | 11033332 |
| Molecular Formula | C22H18 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (2Z)-2-phenyltricyclo[8.2.2.24,7]hexadeca-1(13),2,4,6,10(14),11,15-heptaene |
| SMILES | C1=C(/c2ccccc2)c2ccc(cc2)CCc2ccc/1cc2 |
| InChI | InChI=1S/C22H18/c1-2-4-20(5-3-1)22-16-19-10-8-17(9-11-19)6-7-18-12-14-21(22)15-13-18/h1-5,8-16H,6-7H2/b22-16- |
| InChIKey | GOJYOFQXZLABJL-JWGURIENSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|