C13H17NO6 — CID 11033354
(1R,2R,6S,9R,11S)-3-methyl-4-oxo-11-prop-2-enyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylic acid (PubChem CID 11033354) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is (1R,2R,6S,9R,11S)-3-methyl-4-oxo-11-prop-2-enyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylic acid.
| Compound Name | (1R,2R,6S,9R,11S)-3-methyl-4-oxo-11-prop-2-enyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylic acid |
|---|---|
| PubChem CID | 11033354 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (1R,2R,6S,9R,11S)-3-methyl-4-oxo-11-prop-2-enyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-11-carboxylic acid |
| SMILES | C=CC[C@@]1(C(=O)O)C[C@H]2OC[C@H]3OC(=O)N(C)[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C13H17NO6/c1-3-4-13(11(15)16)5-7-10(20-13)9-8(6-18-7)19-12(17)14(9)2/h3,7-10H,1,4-6H2,2H3,(H,15,16)/t7-,8-,9-,10+,13+/m1/s1 |
| InChIKey | VEJYHQVPYCXZBZ-LGMRYKSHSA-N |
| XLogP | 0.39 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|