About 2-methyl-N,N'-bis(2-methylpropyl)-2-[(2-methylpropylamino)methyl]propane-1,3-diamine
2-methyl-N,N'-bis(2-methylpropyl)-2-[(2-methylpropylamino)methyl]propane-1,3-diamine (PubChem CID 11033430) has the molecular formula C17H39N3
and a molecular weight of 285.52 g/mol. Its IUPAC name is 2-methyl-N,N'-bis(2-methylpropyl)-2-[(2-methylpropylamino)methyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | 2-methyl-N,N'-bis(2-methylpropyl)-2-[(2-methylpropylamino)methyl]propane-1,3-diamine |
| PubChem CID | 11033430 |
| Molecular Formula | C17H39N3 |
| Molecular Weight | 285.52 g/mol |
| Exact Mass | 285.31 |
| IUPAC Name | 2-methyl-N,N'-bis(2-methylpropyl)-2-[(2-methylpropylamino)methyl]propane-1,3-diamine |
| SMILES | CC(C)CNCC(C)(CNCC(C)C)CNCC(C)C |
| InChI | InChI=1S/C17H39N3/c1-14(2)8-18-11-17(7,12-19-9-15(3)4)13-20-10-16(5)6/h14-16,18-20H,8-13H2,1-7H3 |
| InChIKey | OUTADEQAQYCYRC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-N,N'-bis(2-methylpropyl)-2-[(2-methylpropylamino)methyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N,N'-bis(2-methylpropyl)-2-[(2-methylpropylamino)methyl]propane-1,3-diamine?
The IUPAC name of 2-methyl-N,N'-bis(2-methylpropyl)-2-[(2-methylpropylamino)methyl]propane-1,3-diamine (CID 11033430) is 2-methyl-N,N'-bis(2-methylpropyl)-2-[(2-methylpropylamino)methyl]propane-1,3-diamine.
What is the SMILES notation for 2-methyl-N,N'-bis(2-methylpropyl)-2-[(2-methylpropylamino)methyl]propane-1,3-diamine?
The canonical SMILES for 2-methyl-N,N'-bis(2-methylpropyl)-2-[(2-methylpropylamino)methyl]propane-1,3-diamine is CC(C)CNCC(C)(CNCC(C)C)CNCC(C)C.
What is the InChIKey of 2-methyl-N,N'-bis(2-methylpropyl)-2-[(2-methylpropylamino)methyl]propane-1,3-diamine?
The InChIKey is OUTADEQAQYCYRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H39N3/c1-14(2)8-18-11-17(7,12-19-9-15(3)4)13-20-10-16(5)6/h14-16,18-20H,8-13H2,1-7H3.
What are the key properties of 2-methyl-N,N'-bis(2-methylpropyl)-2-[(2-methylpropylamino)methyl]propane-1,3-diamine?
2-methyl-N,N'-bis(2-methylpropyl)-2-[(2-methylpropylamino)methyl]propane-1,3-diamine has a molecular weight of 285.52 g/mol, XLogP of 2.73, 12 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N,N'-bis(2-methylpropyl)-2-[(2-methylpropylamino)methyl]propane-1,3-diamine is sourced from PubChem (CID 11033430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).