C15H30N2O3 — CID 11033464
(2S,3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol (PubChem CID 11033464) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is (2S,3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol.
| Compound Name | (2S,3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol |
|---|---|
| PubChem CID | 11033464 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (2S,3R,4S)-4-amino-5-cyclohexyl-1-morpholin-4-ylpentane-2,3-diol |
| SMILES | N[C@@H](CC1CCCCC1)[C@@H](O)[C@@H](O)CN1CCOCC1 |
| InChI | InChI=1S/C15H30N2O3/c16-13(10-12-4-2-1-3-5-12)15(19)14(18)11-17-6-8-20-9-7-17/h12-15,18-19H,1-11,16H2/t13-,14-,15+/m0/s1 |
| InChIKey | NHDDZVQPIPEHDA-SOUVJXGZSA-N |
| XLogP | 0.34 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |