C16H24N4O5S — CID 110335350
4-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-4-carbonyl]piperazine-1-carbaldehyde (PubChem CID 110335350) has the molecular formula C16H24N4O5S and a molecular weight of 384.46 g/mol. Its IUPAC name is 4-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-4-carbonyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-4-carbonyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 110335350 |
| Molecular Formula | C16H24N4O5S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidine-4-carbonyl]piperazine-1-carbaldehyde |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCC(C(=O)N2CCN(C=O)CC2)CC1 |
| InChI | InChI=1S/C16H24N4O5S/c1-12-15(13(2)25-17-12)26(23,24)20-5-3-14(4-6-20)16(22)19-9-7-18(11-21)8-10-19/h11,14H,3-10H2,1-2H3 |
| InChIKey | WZJDEOGMTFTHNK-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 104.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|