C13H21N5O4S — CID 110335613
N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 110335613) has the molecular formula C13H21N5O4S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 110335613 |
| Molecular Formula | C13H21N5O4S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]-N,3,5-trimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N(C)CC(=O)N1CCN(C=O)CC1 |
| InChI | InChI=1S/C13H21N5O4S/c1-10-13(11(2)15-14-10)23(21,22)16(3)8-12(20)18-6-4-17(9-19)5-7-18/h9H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | MVOHMISHJZCAKU-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|