C18H28N2O5S — CID 110335932
1-(2-methoxyethylsulfonyl)-N-(4-propan-2-yloxyphenyl)piperidine-3-carboxamide (PubChem CID 110335932) has the molecular formula C18H28N2O5S and a molecular weight of 384.50 g/mol. Its IUPAC name is 1-(2-methoxyethylsulfonyl)-N-(4-propan-2-yloxyphenyl)piperidine-3-carboxamide.
| Compound Name | 1-(2-methoxyethylsulfonyl)-N-(4-propan-2-yloxyphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110335932 |
| Molecular Formula | C18H28N2O5S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-(2-methoxyethylsulfonyl)-N-(4-propan-2-yloxyphenyl)piperidine-3-carboxamide |
| SMILES | COCCS(=O)(=O)N1CCCC(C(=O)Nc2ccc(OC(C)C)cc2)C1 |
| InChI | InChI=1S/C18H28N2O5S/c1-14(2)25-17-8-6-16(7-9-17)19-18(21)15-5-4-10-20(13-15)26(22,23)12-11-24-3/h6-9,14-15H,4-5,10-13H2,1-3H3,(H,19,21) |
| InChIKey | UXMJCELGGUJROH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |