C15H18ClN3O — CID 110336255
5-(4-chlorophenyl)-N,N-diethyl-1-methylpyrazole-3-carboxamide (PubChem CID 110336255) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N,N-diethyl-1-methylpyrazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N,N-diethyl-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110336255 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 5-(4-chlorophenyl)-N,N-diethyl-1-methylpyrazole-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(-c2ccc(Cl)cc2)n(C)n1 |
| InChI | InChI=1S/C15H18ClN3O/c1-4-19(5-2)15(20)13-10-14(18(3)17-13)11-6-8-12(16)9-7-11/h6-10H,4-5H2,1-3H3 |
| InChIKey | UNOUDFTUDASZOK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |