About N-[(E)-1,1,1-trifluorodec-2-en-4-yl]cyclohexanamine
N-[(E)-1,1,1-trifluorodec-2-en-4-yl]cyclohexanamine (PubChem CID 11033637) has the molecular formula C16H28F3N
and a molecular weight of 291.40 g/mol. Its IUPAC name is N-[(E)-1,1,1-trifluorodec-2-en-4-yl]cyclohexanamine.
Molecular Properties
| Compound Name | N-[(E)-1,1,1-trifluorodec-2-en-4-yl]cyclohexanamine |
| PubChem CID | 11033637 |
| Molecular Formula | C16H28F3N |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N-[(E)-1,1,1-trifluorodec-2-en-4-yl]cyclohexanamine |
| SMILES | CCCCCCC(/C=C/C(F)(F)F)NC1CCCCC1 |
| InChI | InChI=1S/C16H28F3N/c1-2-3-4-6-11-15(12-13-16(17,18)19)20-14-9-7-5-8-10-14/h12-15,20H,2-11H2,1H3/b13-12+ |
| InChIKey | ULKIKLWVYNMFBW-OUKQBFOZSA-N |
| XLogP | 5.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-1,1,1-trifluorodec-2-en-4-yl]cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1,1,1-trifluorodec-2-en-4-yl]cyclohexanamine?
The IUPAC name of N-[(E)-1,1,1-trifluorodec-2-en-4-yl]cyclohexanamine (CID 11033637) is N-[(E)-1,1,1-trifluorodec-2-en-4-yl]cyclohexanamine.
What is the SMILES notation for N-[(E)-1,1,1-trifluorodec-2-en-4-yl]cyclohexanamine?
The canonical SMILES for N-[(E)-1,1,1-trifluorodec-2-en-4-yl]cyclohexanamine is CCCCCCC(/C=C/C(F)(F)F)NC1CCCCC1.
What is the InChIKey of N-[(E)-1,1,1-trifluorodec-2-en-4-yl]cyclohexanamine?
The InChIKey is ULKIKLWVYNMFBW-OUKQBFOZSA-N. The full InChI is InChI=1S/C16H28F3N/c1-2-3-4-6-11-15(12-13-16(17,18)19)20-14-9-7-5-8-10-14/h12-15,20H,2-11H2,1H3/b13-12+.
What are the key properties of N-[(E)-1,1,1-trifluorodec-2-en-4-yl]cyclohexanamine?
N-[(E)-1,1,1-trifluorodec-2-en-4-yl]cyclohexanamine has a molecular weight of 291.40 g/mol, XLogP of 5.37, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1,1,1-trifluorodec-2-en-4-yl]cyclohexanamine is sourced from PubChem (CID 11033637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).