About 2-carboxybenzoate;1-ethyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium
2-carboxybenzoate;1-ethyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium (PubChem CID 11033658) has the molecular formula C15H20N2O4
and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-carboxybenzoate;1-ethyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium.
Molecular Properties
| Compound Name | 2-carboxybenzoate;1-ethyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium |
| PubChem CID | 11033658 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-carboxybenzoate;1-ethyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium |
| SMILES | CCN1CC[N+](C)=C1C.O=C([O-])c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H6O4.C7H15N2/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-4-9-6-5-8(3)7(9)2/h1-4H,(H,9,10)(H,11,12);4-6H2,1-3H3/q;+1/p-1 |
| InChIKey | ZIJUHZOZVYEUEY-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-carboxybenzoate;1-ethyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxybenzoate;1-ethyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium?
The IUPAC name of 2-carboxybenzoate;1-ethyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium (CID 11033658) is 2-carboxybenzoate;1-ethyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium.
What is the SMILES notation for 2-carboxybenzoate;1-ethyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium?
The canonical SMILES for 2-carboxybenzoate;1-ethyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium is CCN1CC[N+](C)=C1C.O=C([O-])c1ccccc1C(=O)O.
What is the InChIKey of 2-carboxybenzoate;1-ethyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium?
The InChIKey is ZIJUHZOZVYEUEY-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6O4.C7H15N2/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-4-9-6-5-8(3)7(9)2/h1-4H,(H,9,10)(H,11,12);4-6H2,1-3H3/q;+1/p-1.
What are the key properties of 2-carboxybenzoate;1-ethyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium?
2-carboxybenzoate;1-ethyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium has a molecular weight of 292.34 g/mol, XLogP of 0.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxybenzoate;1-ethyl-2,3-dimethyl-4,5-dihydroimidazol-3-ium is sourced from PubChem (CID 11033658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).