C16H22O5 — CID 11033722
prop-2-enyl (3aS,4'R,5'R,6aS)-4',5'-dimethyl-2-oxospiro[1,3,3a,5,6,6a-hexahydropentalene-4,2'-1,3-dioxolane]-1-carboxylate (PubChem CID 11033722) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is prop-2-enyl (3aS,4'R,5'R,6aS)-4',5'-dimethyl-2-oxospiro[1,3,3a,5,6,6a-hexahydropentalene-4,2'-1,3-dioxolane]-1-carboxylate.
| Compound Name | prop-2-enyl (3aS,4'R,5'R,6aS)-4',5'-dimethyl-2-oxospiro[1,3,3a,5,6,6a-hexahydropentalene-4,2'-1,3-dioxolane]-1-carboxylate |
|---|---|
| PubChem CID | 11033722 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | prop-2-enyl (3aS,4'R,5'R,6aS)-4',5'-dimethyl-2-oxospiro[1,3,3a,5,6,6a-hexahydropentalene-4,2'-1,3-dioxolane]-1-carboxylate |
| SMILES | C=CCOC(=O)C1C(=O)C[C@H]2[C@@H]1CCC21O[C@H](C)[C@@H](C)O1 |
| InChI | InChI=1S/C16H22O5/c1-4-7-19-15(18)14-11-5-6-16(12(11)8-13(14)17)20-9(2)10(3)21-16/h4,9-12,14H,1,5-8H2,2-3H3/t9-,10-,11+,12+,14?/m1/s1 |
| InChIKey | WWYLQNOOWSIXCB-MKURHVDASA-N |
| XLogP | 1.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|